CymitQuimica logo

CAS 879996-64-2

:

3-(2,5-Dimethoxyphenyl)-1H-pyrazole-4-carboxaldehyde

Description:
3-(2,5-Dimethoxyphenyl)-1H-pyrazole-4-carboxaldehyde is an organic compound characterized by its pyrazole core, which is a five-membered ring containing two nitrogen atoms. The presence of a carboxaldehyde functional group (-CHO) at the 4-position of the pyrazole ring contributes to its reactivity, particularly in condensation reactions. The 2,5-dimethoxyphenyl substituent enhances the compound's lipophilicity and may influence its biological activity, making it of interest in medicinal chemistry. This compound is likely to exhibit properties typical of aldehydes, such as being a potential electrophile in nucleophilic addition reactions. Additionally, the methoxy groups can provide electron-donating effects, which may stabilize certain reaction intermediates. The compound's structure suggests potential applications in pharmaceuticals or agrochemicals, although specific biological activities would require further investigation. As with many organic compounds, proper handling and storage are essential due to potential reactivity and toxicity.
Formula:C12H12N2O3
InChI:InChI=1S/C12H12N2O3/c1-16-9-3-4-11(17-2)10(5-9)12-8(7-15)6-13-14-12/h3-7H,1-2H3,(H,13,14)
InChI key:InChIKey=KCSSPFHUWREFSY-UHFFFAOYSA-N
SMILES:O(C)C1=C(C=C(OC)C=C1)C=2C(C=O)=CNN2
Synonyms:
  • 3-(2,5-Dimethoxyphenyl)-1H-pyrazole-4-carboxaldehyde
  • 1H-Pyrazole-4-carboxaldehyde, 3-(2,5-dimethoxyphenyl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.