CAS 879996-74-4

1H-Pyrazole-4-carboxylic acid, 3-(2-methoxyphenyl)-

Description:

1H-Pyrazole-4-carboxylic acid, 3-(2-methoxyphenyl)-, identified by its CAS number 879996-74-4, is an organic compound characterized by its pyrazole ring structure, which is a five-membered ring containing two nitrogen atoms. This compound features a carboxylic acid functional group at the 4-position of the pyrazole ring, contributing to its acidic properties. Additionally, it has a 2-methoxyphenyl substituent at the 3-position, which introduces aromatic characteristics and potential for various interactions due to the methoxy group. The presence of both the carboxylic acid and the aromatic ring suggests that this compound may exhibit interesting biological activities and could be of interest in medicinal chemistry. Its solubility, stability, and reactivity would depend on the specific conditions, such as pH and solvent, making it a candidate for further research in drug development or as a chemical intermediate. Overall, this compound's unique structure and functional groups provide a foundation for exploring its potential applications in various fields.

Formula: C₁₁H₁₀N₂O₃

InChI: InChI=1S/C11H10N2O3/c1-16-9-5-3-2-4-7(9)10-8(11(14)15)6-12-13-10/h2-6H,1H3,(H,12,13)(H,14,15)

InChI key: QNZBKSMPPBMFMI-UHFFFAOYSA-N

SMILES: COC1=CC=CC=C1C2=C(C=NN2)C(=O)O