
CAS 88-33-5
:5-Chloro-2-formylbenzenesulfonic acid
Description:
5-Chloro-2-formylbenzenesulfonic acid is an aromatic sulfonic acid characterized by the presence of a chloro group, a formyl group, and a sulfonic acid group attached to a benzene ring. Its molecular structure features a chlorine atom at the 5-position and a formyl group at the 2-position relative to the sulfonic acid group. This compound is typically a white to light yellow solid and is soluble in water due to the presence of the sulfonic acid group, which enhances its polarity. It is used in various chemical syntheses, particularly in the production of dyes and pharmaceuticals. The presence of both the formyl and sulfonic acid functional groups allows for diverse reactivity, making it a valuable intermediate in organic synthesis. Additionally, it may exhibit properties such as acidity due to the sulfonic acid group and potential electrophilicity from the formyl group, which can participate in further chemical reactions. Safety precautions should be taken when handling this compound, as it may be harmful if ingested or inhaled.
Formula:C7H5ClO4S
InChI:InChI=1S/C7H5ClO4S/c8-6-2-1-5(4-9)7(3-6)13(10,11)12/h1-4H,(H,10,11,12)
InChI key:InChIKey=GXRQQNQCMLEUAW-UHFFFAOYSA-N
SMILES:S(=O)(=O)(O)C1=C(C=O)C=CC(Cl)=C1
Synonyms:- Benzenesulfonic acid, 5-chloro-2-formyl-
- 5-Chloro-2-formylbenzenesulfonic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
