CAS 88-39-1
:4-Formyl-1,3-benzenedisulfonic acid
Description:
4-Formyl-1,3-benzenedisulfonic acid, with the CAS number 88-39-1, is an aromatic sulfonic acid characterized by the presence of two sulfonic acid groups and an aldehyde functional group on a benzene ring. This compound typically appears as a white to light yellow crystalline solid and is soluble in water due to the polar nature of its sulfonic acid groups. It is known for its strong acidity, which is attributed to the sulfonic acid moieties, making it useful in various chemical reactions and applications, including as a reagent in organic synthesis and as a dye intermediate. The presence of the aldehyde group allows for further functionalization, enabling its use in the synthesis of more complex organic molecules. Additionally, 4-Formyl-1,3-benzenedisulfonic acid can exhibit properties such as good thermal stability and reactivity towards nucleophiles, making it a valuable compound in both industrial and laboratory settings. Safety precautions should be taken when handling this substance, as it may pose health risks if ingested or inhaled.
Formula:C7H6O7S2
InChI:InChI=1S/C7H6O7S2/c8-4-5-1-2-6(15(9,10)11)3-7(5)16(12,13)14/h1-4H,(H,9,10,11)(H,12,13,14)
InChI key:InChIKey=PQYVGRGYAZDHFY-UHFFFAOYSA-N
SMILES:S(=O)(=O)(O)C1=C(C=O)C=CC(S(=O)(=O)O)=C1
Synonyms:- 1,3-Benzenedisulfonic acid, 4-formyl-
- 2,4-Disulfobenzaldehyde
- 4-Formyl benzene-1,3-disodium disulfonate
- 4-Formyl-1,3-benzenedisulfonic acid
- 4-Formyl-1,3-disulfobenzene
- 4-Formylbenzene-1,3-Disulfonic Acid
- Benzaldehyde-2,4-disulfonic acid
- m-Benzenedisulfonic acid, 4-formyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
