CAS 88-40-4
:1-(1,1-Dimethylethyl)-2-methoxy-4-methylbenzene
Description:
1-(1,1-Dimethylethyl)-2-methoxy-4-methylbenzene, commonly known as p-cymene, is an aromatic hydrocarbon characterized by its distinct structure featuring a methoxy group and a tert-butyl group attached to a benzene ring. This compound is a colorless liquid with a pleasant, aromatic odor, often associated with the scent of citrus. It is soluble in organic solvents but has limited solubility in water. p-Cymene is known for its use in the fragrance industry, as well as in the production of various chemicals and as a solvent in organic synthesis. Its chemical properties include a relatively low boiling point and a moderate vapor pressure, making it volatile under standard conditions. Additionally, p-cymene exhibits antimicrobial properties, which has led to its exploration in various applications, including food preservation and as a potential therapeutic agent. Safety considerations include its flammability and the need for proper handling to avoid inhalation or skin contact.
Formula:C12H18O
InChI:InChI=1/C12H18O/c1-9-6-7-10(12(2,3)4)11(8-9)13-5/h6-8H,1-5H3
InChI key:InChIKey=NFDFEFJTYRAHEM-UHFFFAOYSA-N
SMILES:C(C)(C)(C)C1=C(OC)C=C(C)C=C1
Synonyms:- Anisole, 2-tert-butyl-5-methyl-
- 2-tert-Butyl-5-methylanisole
- 1-tert-butyl-2-methoxy-4-methylbenzene
- 4-tert-butyl-3-methoxytoluene
- Benzene, 1-(1,1-dimethylethyl)-2-methoxy-4-methyl-
- 1-(1,1-Dimethylethyl)-2-methoxy-4-methylbenzene
- 1-tert-Butyl-2-methoxy-4-methylbenzene
- 3-Methoxy-4-tert-butyltoluene
- 1-Methoxy-2-tert-butyl-5-methylbenzene
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
