
CAS 88-52-8
:2,4-Diamino-5-methylbenzenesulfonic acid
Description:
2,4-Diamino-5-methylbenzenesulfonic acid, also known as sulfanilic acid, is an organic compound characterized by its sulfonic acid functional group and two amino groups attached to a methyl-substituted benzene ring. It appears as a white to light yellow crystalline solid and is soluble in water, making it useful in various applications. The presence of amino groups contributes to its basicity and reactivity, allowing it to participate in various chemical reactions, including diazotization and coupling reactions, which are important in dye synthesis. This compound is commonly used in the manufacture of azo dyes, as well as in analytical chemistry for the determination of nitrite and nitrate ions. Additionally, it has applications in the pharmaceutical industry and as a reagent in various chemical syntheses. Due to its sulfonic acid group, it exhibits acidic properties, and its structure allows for potential interactions with biological systems, although safety and handling precautions should be observed due to its potential toxicity.
Formula:C7H10N2O3S
InChI:InChI=1S/C7H10N2O3S/c1-4-2-7(13(10,11)12)6(9)3-5(4)8/h2-3H,8-9H2,1H3,(H,10,11,12)
InChI key:InChIKey=XAQCYASNAMYTQA-UHFFFAOYSA-N
SMILES:S(=O)(=O)(O)C1=C(N)C=C(N)C(C)=C1
Synonyms:- m-Toluenesulfonic acid, 4,6-diamino-
- 2,4-Diamino-5-methylbenzenesulfonic acid
- 5-Amino-4-sulfo-o-toluidine
- 2,4-Tolylenediamine-5-sulfonic acid
- Benzenesulfonic acid, 2,4-diamino-5-methyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
