CAS 880-50-2
:3-fluorotricyclo[3.3.1.1~3,7~]decane-1-carboxylic acid
Description:
3-Fluorotricyclo[3.3.1.1^3,7]decane-1-carboxylic acid, with the CAS number 880-50-2, is a bicyclic organic compound characterized by its unique tricyclic structure, which includes a carboxylic acid functional group and a fluorine substituent. This compound exhibits a rigid three-dimensional framework due to its tricyclic nature, which can influence its reactivity and interaction with biological systems. The presence of the carboxylic acid group contributes to its acidity and potential for forming hydrogen bonds, while the fluorine atom can enhance lipophilicity and alter the compound's electronic properties. Such characteristics make it of interest in various fields, including medicinal chemistry and materials science, where fluorinated compounds often exhibit enhanced stability and bioactivity. The compound's specific stereochemistry and spatial arrangement can also play a crucial role in its chemical behavior and potential applications. Overall, 3-fluorotricyclo[3.3.1.1^3,7]decane-1-carboxylic acid represents a fascinating example of how structural features can dictate the properties and uses of organic molecules.
Formula:C11H15FO2
InChI:InChI=1/C11H15FO2/c12-11-4-7-1-8(5-11)3-10(2-7,6-11)9(13)14/h7-8H,1-6H2,(H,13,14)
SMILES:C1C2CC3(CC1CC(C2)(C3)F)C(=O)O
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
