CAS 880-83-1
:6-hydrazinyl-3-methyl-5-nitropyrimidine-2,4(3H,5H)-dione
Description:
6-Hydrazinyl-3-methyl-5-nitropyrimidine-2,4(3H,5H)-dione, with the CAS number 880-83-1, is a chemical compound that belongs to the class of pyrimidine derivatives. This substance features a hydrazine functional group, which is indicative of its potential reactivity and biological activity. The presence of a nitro group suggests that it may exhibit unique electronic properties and could participate in various chemical reactions, including reduction processes. The methyl group contributes to the compound's hydrophobic characteristics, potentially influencing its solubility and interaction with biological systems. As a pyrimidine derivative, it may be of interest in medicinal chemistry, particularly in the development of pharmaceuticals, due to its structural features that can interact with biological targets. The compound's stability, reactivity, and potential applications in synthesis or as a biological agent would depend on its specific chemical environment and conditions. Overall, 6-hydrazinyl-3-methyl-5-nitropyrimidine-2,4(3H,5H)-dione represents a versatile structure with potential implications in various fields of chemistry and pharmacology.
Formula:C5H7N5O4
InChI:InChI=1/C5H7N5O4/c1-9-4(11)2(10(13)14)3(8-6)7-5(9)12/h2H,6H2,1H3,(H,7,8,12)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
6-hydrazinyl-3-methyl-5-nitropyrimidine-2,4(3h,5h)-dione
CAS:Formula:C5H7N5O4Molecular weight:201.1402
