CAS 88007-98-1

1,4-Naphthalenedione, 2-methyl-3-(2-oxo-2-phenylethyl)-

Description:

1,4-Naphthalenedione, 2-methyl-3-(2-oxo-2-phenylethyl)-, also known by its CAS number 88007-98-1, is an organic compound characterized by its naphthalene backbone, which is a fused bicyclic aromatic hydrocarbon. This compound features a naphthalenedione structure, indicating the presence of two carbonyl (C=O) groups at the 1 and 4 positions of the naphthalene ring. The additional substituents include a methyl group at the 2 position and a phenyl group attached to a ketone functional group at the 3 position, contributing to its overall reactivity and potential applications. The presence of both aromatic and carbonyl functionalities suggests that this compound may exhibit interesting electronic properties and could participate in various chemical reactions, such as nucleophilic additions or electrophilic substitutions. Its unique structure may also impart specific biological activities, making it a subject of interest in medicinal chemistry and materials science. However, detailed studies on its physical properties, solubility, and reactivity would be necessary to fully understand its potential applications.

Formula: C₁₉H₁₄O₃

InChI: InChI=1S/C19H14O3/c1-12-16(11-17(20)13-7-3-2-4-8-13)19(22)15-10-6-5-9-14(15)18(12)21/h2-10H,11H2,1H3

InChI key: QKJWXHMJMZXPLX-UHFFFAOYSA-N

SMILES: CC1=C(C(=O)C2=CC=CC=C2C1=O)CC(=O)C3=CC=CC=C3

Synonyms:

• 1,4-Naphthalenedione, 2-methyl-3-(2-oxo-2-phenylethyl)-