CAS 88007-99-2
:2-Methyl-3-[2-(4-nitrophenyl)-2-oxoethyl]-1,4-naphthalenedione
Description:
2-Methyl-3-[2-(4-nitrophenyl)-2-oxoethyl]-1,4-naphthalenedione, commonly referred to as a derivative of naphthoquinone, exhibits several notable characteristics. This compound features a naphthalene backbone, which contributes to its aromatic properties and potential for π-π stacking interactions. The presence of the 4-nitrophenyl group introduces electron-withdrawing characteristics, enhancing the compound's reactivity and solubility in polar solvents. The ketone functional groups in the structure suggest potential for redox activity, making it a candidate for applications in organic synthesis and as a dye or pigment. Additionally, the methyl group at the 2-position can influence the compound's steric and electronic properties, affecting its overall stability and reactivity. The compound's molecular structure may also allow for interactions with biological systems, indicating potential pharmacological applications. Overall, 2-Methyl-3-[2-(4-nitrophenyl)-2-oxoethyl]-1,4-naphthalenedione is characterized by its complex structure, reactivity, and potential utility in various chemical and biological contexts.
Formula:C19H13NO5
InChI:InChI=1S/C19H13NO5/c1-11-16(19(23)15-5-3-2-4-14(15)18(11)22)10-17(21)12-6-8-13(9-7-12)20(24)25/h2-9H,10H2,1H3
InChI key:InChIKey=HOUITNAJHFPESJ-UHFFFAOYSA-N
SMILES:O=C1C=2C(C(=O)C(C)=C1CC(=O)C3=CC=C(N(=O)=O)C=C3)=CC=CC2
Synonyms:- 2-Methyl-3-(4-nitrophenacyl)-1,4-naphthoquinone
- 2-Methyl-3-[2-(4-nitrophenyl)-2-oxoethyl]-1,4-naphthalenedione
- 1,4-Naphthalenedione, 2-methyl-3-[2-(4-nitrophenyl)-2-oxoethyl]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.