CymitQuimica logo

CAS 880166-11-0

:

1-[[(1,1-Dimethylethoxy)carbonyl]amino]cyclobutanecarboxylic acid hydrazide

Description:
1-[[(1,1-Dimethylethoxy)carbonyl]amino]cyclobutanecarboxylic acid hydrazide, with the CAS number 880166-11-0, is a chemical compound characterized by its unique structural features, which include a cyclobutane ring and a hydrazide functional group. This compound is likely to exhibit properties typical of hydrazides, such as the ability to form hydrogen bonds due to the presence of the hydrazine moiety, which can influence its solubility and reactivity. The presence of the 1,1-dimethylethoxycarbonyl group suggests that it may have steric hindrance, potentially affecting its reactivity and interactions with other molecules. Additionally, the cyclobutane structure may impart rigidity to the molecule, influencing its conformational dynamics. Such compounds can be of interest in medicinal chemistry and materials science due to their potential biological activity and utility in synthesizing more complex molecules. However, specific physical and chemical properties such as melting point, boiling point, and solubility would require empirical determination or literature reference for precise values.
Formula:C10H19N3O3
InChI:InChI=1S/C10H19N3O3/c1-9(2,3)16-8(15)12-10(5-4-6-10)7(14)13-11/h4-6,11H2,1-3H3,(H,12,15)(H,13,14)
InChI key:InChIKey=QVESIVAXVFLNLD-UHFFFAOYSA-N
SMILES:N(C(OC(C)(C)C)=O)C1(C(NN)=O)CCC1
Synonyms:
  • Cyclobutanecarboxylic acid, 1-[[(1,1-dimethylethoxy)carbonyl]amino]-, hydrazide
  • 1-[[(1,1-Dimethylethoxy)carbonyl]amino]cyclobutanecarboxylic acid hydrazide
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.