CAS 880251-15-0
:1-(1-benzothiophen-7-yl)methanamine
Description:
1-(1-benzothiophen-7-yl)methanamine, identified by its CAS number 880251-15-0, is an organic compound characterized by the presence of a benzothiophene moiety attached to a methanamine group. This compound features a benzothiophene ring, which is a fused bicyclic structure consisting of a benzene ring and a thiophene ring, contributing to its aromatic properties and potential biological activity. The methanamine functional group introduces an amine (-NH2) functionality, which can participate in hydrogen bonding and may influence the compound's solubility and reactivity. The presence of both aromatic and amine functionalities suggests that this compound may exhibit interesting pharmacological properties, making it a subject of interest in medicinal chemistry. Additionally, its structural characteristics may allow for interactions with various biological targets, potentially leading to applications in drug development. However, specific physical and chemical properties such as melting point, boiling point, and solubility would require empirical data for comprehensive characterization.
Formula:C9H9NS
InChI:InChI=1/C9H9NS/c10-6-8-3-1-2-7-4-5-11-9(7)8/h1-5H,6,10H2
SMILES:c1cc2ccsc2c(c1)CN
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
