CAS 880361-69-3

N-[(1,3,5-trimethylpyrazol-4-yl)methyl]propan-2-amine

Description:

N-[(1,3,5-trimethylpyrazol-4-yl)methyl]propan-2-amine, identified by its CAS number 880361-69-3, is a chemical compound characterized by its unique structure that includes a propan-2-amine backbone and a trimethylpyrazole moiety. This compound typically exhibits properties associated with amines, such as basicity and the ability to form hydrogen bonds, which can influence its solubility in various solvents. The presence of the pyrazole ring contributes to its potential biological activity, making it of interest in pharmaceutical research. The trimethyl groups on the pyrazole enhance steric hindrance, which may affect the compound's reactivity and interaction with biological targets. Additionally, the compound's molecular structure suggests potential applications in agrochemicals or as a ligand in coordination chemistry. Its stability, reactivity, and specific interactions would depend on the surrounding conditions, such as pH and temperature, as well as the presence of other chemical species. Overall, this compound represents a fascinating area of study within organic and medicinal chemistry.

Formula: C₁₀H₁₉N₃

InChI: InChI=1/C10H19N3/c1-7(2)11-6-10-8(3)12-13(5)9(10)4/h7,11H,6H2,1-5H3

SMILES: CC(C)NCc1c(C)nn(C)c1C

N-[(1,3,5-trimethyl-1H-pyrazol-4-yl)methyl]propan-2-amine

CAS: 880361-69-3

Formula: C₁₀H₁₉N₃

Purity: 95.0%

Molecular weight: 181.283

Ref: 10-F313622