CAS 880361-71-7

1-[(1-methylimidazol-2-yl)methyl]piperazine

Description:

1-[(1-methylimidazol-2-yl)methyl]piperazine is a chemical compound characterized by its unique structure, which includes a piperazine ring and a 1-methylimidazole moiety. This compound typically exhibits properties associated with both heterocyclic amines and piperazine derivatives, making it of interest in medicinal chemistry and pharmacology. It is likely to be a polar substance due to the presence of nitrogen atoms in both the piperazine and imidazole rings, which can engage in hydrogen bonding. The compound may also display basic properties, allowing it to interact with various biological targets. Its potential applications could include roles as a pharmaceutical intermediate or in the development of novel therapeutic agents, particularly in the fields of neuropharmacology or as ligands in coordination chemistry. As with many organic compounds, its solubility, stability, and reactivity can be influenced by environmental factors such as pH and temperature. Safety data and handling precautions should be consulted, as with any chemical substance, to ensure proper laboratory practices.

Formula: C₉H₁₆N₄

InChI: InChI=1/C9H16N4/c1-12-5-4-11-9(12)8-13-6-2-10-3-7-13/h4-5,10H,2-3,6-8H2,1H3

SMILES: Cn1ccnc1CN1CCNCC1

Synonyms:

• 1-[(1-methyl-1H-imidazol-2-yl)methyl]piperazine
• piperazine, 1-[(1-methyl-1H-imidazol-2-yl)methyl]-

1-[(1-methyl-1H-imidazol-2-yl)methyl]piperazine

Controlled Product

CAS: 880361-71-7

Versatile small molecule scaffold

Formula: C₉H₁₆N₄

Purity: Min. 95%

Molecular weight: 180.25 g/mol

Ref: 3D-FKB36171