CAS 880361-91-1

N,5-Dimethyl-1H-pyrazole-3-methanamine

Description:

N,5-Dimethyl-1H-pyrazole-3-methanamine is an organic compound characterized by its pyrazole ring structure, which is a five-membered ring containing two nitrogen atoms. This compound features two methyl groups at the nitrogen positions (N-1 and N-5) and a methanamine group at the 3-position of the pyrazole ring. Its molecular structure contributes to its potential as a ligand in coordination chemistry and as a building block in organic synthesis. The presence of the amine group suggests it may exhibit basic properties and can participate in hydrogen bonding, influencing its solubility and reactivity. Additionally, the compound may have applications in pharmaceuticals or agrochemicals, given the significance of pyrazole derivatives in medicinal chemistry. Its CAS number, 880361-91-1, allows for precise identification and retrieval of information regarding its properties, safety data, and potential uses in various chemical contexts. As with many organic compounds, handling should be done with care, considering safety protocols to mitigate any risks associated with its use.

Formula: C₆H₁₁N₃

InChI: InChI=1S/C6H11N3/c1-5-3-6(4-7-2)9-8-5/h3,7H,4H2,1-2H3,(H,8,9)

InChI key: InChIKey=HEWBDSWDDPJBLU-UHFFFAOYSA-N

SMILES: C(NC)C=1C=C(C)NN1

Synonyms:

• N-Methyl-1-(5-methyl-1H-pyrazol-3-yl)methanamine
• N,5-Dimethyl-1H-pyrazole-3-methanamine
• 1H-Pyrazole-3-methanamine, N,5-dimethyl-