CAS 880361-97-7
:N,N-Dimethyl-2-(4-piperidinyloxy)acetamide
Description:
N,N-Dimethyl-2-(4-piperidinyloxy)acetamide, with the CAS number 880361-97-7, is a chemical compound characterized by its unique structure, which includes a piperidine ring and a dimethylacetamide moiety. This compound typically exhibits properties such as being a colorless to pale yellow liquid or solid, depending on its purity and form. It is soluble in polar organic solvents, which is indicative of its polar functional groups. The presence of the piperidinyloxy group suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, as it may interact with biological targets due to its ability to form hydrogen bonds and engage in dipole-dipole interactions. Additionally, the dimethylamide portion contributes to its lipophilicity, enhancing membrane permeability. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper precautions are taken due to potential toxicity or reactivity. Overall, this compound's structural features make it of interest in various chemical and biological research fields.
Formula:C10H22N2O2
InChI:InChI=1/C7H15NO.C3H7NO/c1-2-9-7-3-5-8-6-4-7;1-4(2)3-5/h7-8H,2-6H2,1H3;3H,1-2H3
SMILES:CCOC1CCNCC1.CN(C)C=O
Synonyms:- N,N-dimethylformamide, 4-ethoxypiperidine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
