CAS 880362-05-0

1-(3-Methyl-2-pyridyl)homopiperazine

Description:

1-(3-Methyl-2-pyridyl)homopiperazine is a chemical compound characterized by its unique structure, which includes a homopiperazine ring and a pyridine moiety. The presence of the 3-methyl group on the pyridine ring contributes to its lipophilicity, potentially influencing its biological activity and solubility properties. This compound is often studied for its pharmacological potential, particularly in the context of neuropharmacology, due to the piperazine structure, which is known to interact with various neurotransmitter receptors. The molecular formula and specific stereochemistry can affect its reactivity and interactions with biological systems. Additionally, the compound may exhibit properties such as moderate to high melting points and solubility in organic solvents, making it suitable for various synthetic applications. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper laboratory practices are followed. Overall, 1-(3-Methyl-2-pyridyl)homopiperazine represents a compound of interest in medicinal chemistry and related fields.

Formula: C₁₁H₁₇N₃

InChI: InChI=1/C11H17N3/c1-10-4-2-6-13-11(10)14-8-3-5-12-7-9-14/h2,4,6,12H,3,5,7-9H2,1H3

SMILES: Cc1cccnc1N1CCCNCC1

Synonyms:

• 1-(3-Methyl-2-pyridinyl)-1,4-diazepan
• 1-(3-Methyl-2-pyridinyl)-1,4-diazepane
• 1-(3-Methylpyridin-2-Yl)-1,4-Diazepane
• 1H-1,4-diazepine, hexahydro-1-(3-methyl-2-pyridinyl)-
• 1-(3-Methyl-2-Pyridyl)-1,4-Diazepane

1-(3-Methylpyridin-2-yl)1,4-diazepane

CAS: 880362-05-0

Formula: C₁₁H₁₇N₃

Molecular weight: 191.2728

Ref: IN-DA003CXL