CAS 88038-94-2
:4'-n-Propyl-4-biphenylcarboxylic acid
Description:
4'-n-Propyl-4-biphenylcarboxylic acid, with the CAS number 88038-94-2, is an organic compound characterized by its biphenyl structure substituted with a propyl group and a carboxylic acid functional group. This compound typically exhibits properties associated with both aromatic compounds and carboxylic acids, such as moderate solubility in organic solvents and potential for hydrogen bonding due to the carboxylic acid group. The presence of the propyl group influences its hydrophobic characteristics, which can affect its interactions in various chemical environments. This compound may be utilized in materials science, particularly in the development of liquid crystals or as an intermediate in organic synthesis. Its melting and boiling points, as well as its reactivity, would depend on the specific molecular interactions and the presence of functional groups. Overall, 4'-n-Propyl-4-biphenylcarboxylic acid is a versatile compound with applications in both research and industrial settings.
Formula:C16H16O2
InChI:InChI=1/C16H16O2/c1-2-3-12-4-6-13(7-5-12)14-8-10-15(11-9-14)16(17)18/h4-11H,2-3H2,1H3,(H,17,18)
SMILES:CCCc1ccc(cc1)c1ccc(cc1)C(=O)O
Synonyms:- [1,1'-Biphenyl]-4-carboxylic acid, 4'-propyl-
- 4'-Propylbiphenyl-4-carboxylic acid
- 4-(4-n-Propylphenyl)benzoic acid
- 4-n-Propylbiphenyl-4-carboxylic acid
- Rarechem Al Bo 0888
- 4-(p-n-Propylphenyl)benzoic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
4-(4-Propylphenyl)benzoic Acid
CAS:Formula:C16H16O2Purity:>98.0%(GC)(T)Color and Shape:White to Orange to Green powder to crystalMolecular weight:240.304-Propyl-[1,1-Biphenyl]-4-carboxylic acid
CAS:Formula:C16H16O2Purity:98%Color and Shape:SolidMolecular weight:240.2970Ref: IN-DA003M02
1g21.00€5g28.00€10g49.00€15g61.00€25g62.00€50g119.00€75g139.00€100g172.00€250g270.00€4’-Propyl-[1,1’-Biphenyl]-4-Carboxylic Acid
CAS:4’-Propyl-[1,1’-Biphenyl]-4-Carboxylic AcidPurity:98%Molecular weight:240.30g/mol4-(4-Propylphenyl)benzoic acid
CAS:4-(4-Propylphenyl)benzoic acid is a high quality, reagent and complex compound that is useful as an intermediate or fine chemical in the synthesis of speciality chemicals. It is also a versatile building block for the synthesis of organic compounds. 4-(4-Propylphenyl)benzoic acid can be used as a reaction component to synthesize other compounds. CAS No. 88038-94-2
Formula:C16H16O2Purity:Min. 95%Color and Shape:PowderMolecular weight:240.3 g/molRef: 3D-FP61799
Discontinued product




