CAS 88045-68-5

Naphthalene, 1-[(chloromethoxy)methyl]-

Description:

Naphthalene, 1-[(chloromethoxy)methyl]- is an organic compound characterized by its structure, which includes a naphthalene ring substituted with a chloromethoxy group. This compound typically exhibits properties associated with both aromatic hydrocarbons and halogenated compounds. It is likely to be a colorless to pale yellow solid at room temperature, with a characteristic odor reminiscent of mothballs, due to the presence of the naphthalene moiety. The chloromethoxy group introduces polar characteristics, which may enhance its solubility in organic solvents while potentially limiting its solubility in water. Naphthalene derivatives often display interesting chemical reactivity, including electrophilic substitution and nucleophilic reactions, due to the electron-rich nature of the aromatic system. Additionally, this compound may have applications in various fields, including organic synthesis and materials science, although specific uses would depend on its reactivity and functional properties. Safety considerations are important, as naphthalene and its derivatives can be toxic and should be handled with appropriate precautions.

Formula: C₁₂H₁₁ClO

InChI: InChI=1S/C12H11ClO/c13-9-14-8-11-6-3-5-10-4-1-2-7-12(10)11/h1-7H,8-9H2

InChI key: WNTLAIKNTSXITD-UHFFFAOYSA-N

SMILES: C1=CC=C2C(=C1)C=CC=C2COCCl