
CAS 88046-02-0
:2-Bromo-4-(1-piperidinylmethyl)pyridine
Description:
2-Bromo-4-(1-piperidinylmethyl)pyridine is a chemical compound characterized by its pyridine ring, which is substituted at the 2-position with a bromine atom and at the 4-position with a piperidinylmethyl group. This structure imparts specific properties, including potential biological activity, making it of interest in medicinal chemistry. The presence of the bromine atom enhances the compound's reactivity and may influence its interaction with biological targets. The piperidine moiety contributes to the compound's lipophilicity and can facilitate binding to various receptors or enzymes. Typically, compounds like this are evaluated for their pharmacological properties, including their efficacy and safety profiles in biological systems. Additionally, the compound's solubility, stability, and reactivity can be influenced by its functional groups and overall molecular structure. As with many organic compounds, proper handling and storage are essential due to potential hazards associated with brominated compounds and nitrogen-containing heterocycles.
Formula:C11H15BrN2
InChI:InChI=1S/C11H15BrN2/c12-11-8-10(4-5-13-11)9-14-6-2-1-3-7-14/h4-5,8H,1-3,6-7,9H2
InChI key:InChIKey=ZTUBSWOWTOUXJJ-UHFFFAOYSA-N
SMILES:C(C=1C=C(Br)N=CC1)N2CCCCC2
Synonyms:- Pyridine, 2-bromo-4-(1-piperidinylmethyl)-
- 2-Bromo-4-(1-piperidinylmethyl)pyridine
- 2-Bromo-4-[(piperidin-1-yl)methyl]pyridine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
