CAS 880466-46-6

4-(8-Chloro-1,7-naphthyridin-6-yl)cyclohexanecarboxylic acid

Description:

4-(8-Chloro-1,7-naphthyridin-6-yl)cyclohexanecarboxylic acid is a chemical compound characterized by its unique structure, which includes a cyclohexanecarboxylic acid moiety and a chloro-substituted naphthyridine ring. This compound typically exhibits properties such as moderate solubility in organic solvents and potential bioactivity due to the presence of the naphthyridine group, which is often associated with pharmacological activity. The chloro substituent can influence the compound's reactivity and interaction with biological targets. As a carboxylic acid, it possesses acidic properties, allowing it to participate in various chemical reactions, including esterification and amidation. The compound may also exhibit specific melting and boiling points, which are important for its characterization and application in research or pharmaceutical development. Overall, its structural features suggest potential utility in medicinal chemistry, particularly in the development of new therapeutic agents.

Formula: C₁₅H₁₅ClN₂O₂

InChI: InChI=1S/C15H15ClN2O2/c16-14-13-11(2-1-7-17-13)8-12(18-14)9-3-5-10(6-4-9)15(19)20/h1-2,7-10H,3-6H2,(H,19,20)

InChI key: InChIKey=GIVORNHULGHDDN-UHFFFAOYSA-N

SMILES: ClC1=NC(=CC2=C1N=CC=C2)C3CCC(C(O)=O)CC3

Synonyms:

• 4-(8-Chloro-1,7-naphthyridin-6-yl)cyclohexanecarboxylic acid
• Cyclohexanecarboxylic acid, 4-(8-chloro-1,7-naphthyridin-6-yl)-