CAS 88048-34-4

5H-1,3-Dioxolo[4,5-f]indole, 7-[2-[4-(4-fluorophenyl)-1-piperazinyl]ethyl]-

Description:

5H-1,3-Dioxolo[4,5-f]indole, 7-[2-[4-(4-fluorophenyl)-1-piperazinyl]ethyl]- is a complex organic compound characterized by its unique bicyclic structure that incorporates a dioxole and indole moiety. This compound features a piperazine ring substituted with a 4-fluorophenyl group, which contributes to its pharmacological properties. The presence of the dioxole ring enhances its potential for forming hydrogen bonds, influencing its solubility and reactivity. Typically, compounds of this nature are investigated for their biological activity, particularly in the fields of medicinal chemistry and drug development, often targeting neurotransmitter systems due to the piperazine component. The fluorine substitution can modulate the lipophilicity and metabolic stability of the molecule, potentially improving its efficacy and bioavailability. Overall, this compound exemplifies the intricate relationship between molecular structure and biological function, making it a subject of interest in pharmaceutical research.

Formula: C₂₁H₂₂FN₃O₂

InChI: InChI=1S/C21H22FN3O2/c22-16-1-3-17(4-2-16)25-9-7-24(8-10-25)6-5-15-13-23-19-12-21-20(11-18(15)19)26-14-27-21/h1-4,11-13,23H,5-10,14H2

InChI key: ZHOMMYSMUMQXCW-UHFFFAOYSA-N

SMILES: C1CN(CCN1CCC2=CNC3=CC4=C(C=C32)OCO4)C5=CC=C(C=C5)F