CAS 88048-77-5

2-Thiophenecarboxylic acid, 3-[(2-thienylthio)methyl]-

Description:

2-Thiophenecarboxylic acid, 3-[(2-thienylthio)methyl]- is an organic compound characterized by the presence of a thiophene ring, which is a five-membered aromatic heterocycle containing sulfur. This compound features a carboxylic acid functional group (-COOH) that contributes to its acidic properties and potential reactivity in various chemical reactions. The presence of the thienylthio group indicates that there is a sulfur atom bonded to a thiophene moiety, which can influence the compound's electronic properties and reactivity. Generally, compounds like this may exhibit interesting biological activities, making them of interest in pharmaceutical research. Additionally, the presence of multiple thiophene units can enhance the compound's solubility and stability in organic solvents. The molecular structure suggests potential applications in materials science, particularly in organic electronics or as intermediates in the synthesis of more complex molecules. Overall, the unique combination of functional groups and aromatic systems in this compound contributes to its diverse chemical behavior and potential utility in various fields.

Formula: C₁₀H₈O₂S₃

InChI: InChI=1S/C10H8O2S3/c11-10(12)9-7(3-5-14-9)6-15-8-2-1-4-13-8/h1-5H,6H2,(H,11,12)

InChI key: HVHNXISGUXWPSS-UHFFFAOYSA-N

SMILES: C1=CSC(=C1)SCC2=C(SC=C2)C(=O)O