CAS 880486-13-5

Benzene, 1-chloro-3-[[(4-chlorophenyl)methyl]thio]-

Description:

Benzene, 1-chloro-3-[[(4-chlorophenyl)methyl]thio]- is an organic compound characterized by its aromatic structure, which includes a benzene ring substituted with a chlorine atom and a thioether group. The presence of the thioether linkage, specifically a methylthio group attached to a 4-chlorophenyl moiety, contributes to its unique chemical properties. This compound is likely to exhibit moderate to high lipophilicity due to the aromatic and chlorinated substituents, which can influence its solubility in organic solvents. Additionally, the chlorine atoms present in the structure may impart certain reactivity, making it a potential candidate for further chemical transformations. The compound may also exhibit biological activity, which is common among chlorinated aromatic compounds, and could be of interest in various fields such as pharmaceuticals or agrochemicals. Safety and handling precautions should be observed due to the potential toxicity associated with chlorinated compounds. Overall, its structural features suggest a complex interplay of physical and chemical properties that warrant further investigation.

Formula: C₁₃H₁₀Cl₂S

InChI: InChI=1S/C13H10Cl2S/c14-11-6-4-10(5-7-11)9-16-13-3-1-2-12(15)8-13/h1-8H,9H2

InChI key: MQNILHUSCIKGBV-UHFFFAOYSA-N

SMILES: C1=CC(=CC(=C1)Cl)SCC2=CC=C(C=C2)Cl