
CAS 880494-17-7
:Methyl 2-[(2-pyridinylmethyl)amino]benzoate
Description:
Methyl 2-[(2-pyridinylmethyl)amino]benzoate, identified by its CAS number 880494-17-7, is an organic compound characterized by its structure, which includes a benzoate moiety and a pyridine ring. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, including potential solubility in organic solvents and moderate polarity. The presence of the methyl ester group suggests it may participate in esterification and hydrolysis reactions. The pyridine ring contributes to its basicity and potential for coordination with metal ions, which can influence its reactivity and applications in medicinal chemistry or as a ligand in coordination chemistry. Additionally, the compound may exhibit biological activity, making it of interest in pharmaceutical research. Its synthesis often involves standard organic reactions such as amination and esterification, and it may be characterized using techniques like NMR, IR spectroscopy, and mass spectrometry to confirm its structure and purity. Overall, Methyl 2-[(2-pyridinylmethyl)amino]benzoate is a versatile compound with potential applications in various chemical and biological fields.
Formula:C14H14N2O2
InChI:InChI=1S/C14H14N2O2/c1-18-14(17)12-7-2-3-8-13(12)16-10-11-6-4-5-9-15-11/h2-9,16H,10H2,1H3
InChI key:InChIKey=ZDSSMOFQNIHBTJ-UHFFFAOYSA-N
SMILES:N(CC1=CC=CC=N1)C2=C(C(OC)=O)C=CC=C2
Synonyms:- Methyl 2-[(2-pyridinylmethyl)amino]benzoate
- 2-[(Pyridin-2-ylmethyl)-amino]-benzoic acid methyl ester
- Benzoic acid, 2-[(2-pyridinylmethyl)amino]-, methyl ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.