CAS 88050-55-9

2,4,6-Cycloheptatrien-1-one, 2-(2-butenylthio)-, (E)-

Description:

2,4,6-Cycloheptatrien-1-one, 2-(2-butenylthio)-, (E)-, with the CAS number 88050-55-9, is an organic compound characterized by its unique structure that includes a cycloheptatriene ring and a butenylthio substituent. This compound features a conjugated system, which contributes to its potential reactivity and stability. The presence of the carbonyl group (ketone) in the cycloheptatriene framework suggests that it may exhibit electrophilic properties, making it a candidate for various chemical reactions, including nucleophilic additions. The (E)-configuration indicates that the butenylthio group is positioned in a trans arrangement relative to the cycloheptatriene ring, which can influence its physical properties and reactivity. This compound may be of interest in synthetic organic chemistry and materials science due to its potential applications in the development of novel compounds or as intermediates in chemical synthesis. However, specific data regarding its physical properties, such as boiling point, melting point, and solubility, would require further investigation or reference to specialized databases.

Formula: C₁₁H₁₂OS

InChI: InChI=1S/C11H12OS/c1-2-3-9-13-11-8-6-4-5-7-10(11)12/h2-8H,9H2,1H3

InChI key: KLPFAPQQVRISID-UHFFFAOYSA-N

SMILES: CC=CCSC1=CC=CC=CC1=O