CAS 88050-92-4

2(3H)-Furanone, 3-bromo-4-(diethylamino)dihydro-5-methoxy-

Description:

2(3H)-Furanone, 3-bromo-4-(diethylamino)dihydro-5-methoxy- is an organic compound characterized by its furanone structure, which includes a five-membered lactone ring. This compound features a bromine atom and a diethylamino group, contributing to its unique chemical properties and potential biological activity. The presence of the methoxy group enhances its solubility and reactivity. Typically, compounds of this nature may exhibit various pharmacological effects, making them of interest in medicinal chemistry. The diethylamino moiety can influence the compound's interaction with biological targets, potentially affecting its efficacy and selectivity. Additionally, the bromine substituent may play a role in the compound's reactivity and stability. As with many organic compounds, the specific characteristics, such as melting point, boiling point, and solubility, would depend on the molecular interactions and the environment in which the compound is studied. Overall, this compound represents a class of substances that may have applications in drug development or as intermediates in organic synthesis.

Formula: C₉H₁₆BrNO₃

InChI: InChI=1S/C9H16BrNO3/c1-4-11(5-2)7-6(10)8(12)14-9(7)13-3/h6-7,9H,4-5H2,1-3H3

InChI key: WKBRNRUVUPTHCI-UHFFFAOYSA-N

SMILES: CCN(CC)C1C(C(=O)OC1OC)Br