CAS 88050-95-7

2(3H)-Furanone, 3-chlorodihydro-5-methoxy-4-(1-piperidinyl)-

Description:

2(3H)-Furanone, 3-chlorodihydro-5-methoxy-4-(1-piperidinyl)-, with the CAS number 88050-95-7, is a synthetic organic compound characterized by its furanone structure, which includes a five-membered lactone ring. This compound features a chlorine atom and a methoxy group, contributing to its unique chemical properties. The presence of the piperidine moiety suggests potential biological activity, as piperidine derivatives are often associated with pharmacological effects. The compound is likely to exhibit moderate solubility in organic solvents due to its polar functional groups, while its stability may be influenced by the presence of the chlorine atom, which can affect reactivity. Additionally, the furanone ring can participate in various chemical reactions, such as nucleophilic substitutions or cycloadditions. Overall, this compound's structure indicates potential applications in medicinal chemistry, particularly in the development of new therapeutic agents. However, specific biological activities and safety profiles would require further investigation through empirical studies.

Formula: C₁₀H₁₆ClNO₃

InChI: InChI=1S/C10H16ClNO3/c1-14-10-8(7(11)9(13)15-10)12-5-3-2-4-6-12/h7-8,10H,2-6H2,1H3

InChI key: KPRUBMSBGPXREG-UHFFFAOYSA-N

SMILES: COC1C(C(C(=O)O1)Cl)N2CCCCC2