CAS 88051-11-0
:3-bromo-2-phenylfuro[2,3-b]quinoxaline
Description:
3-Bromo-2-phenylfuro[2,3-b]quinoxaline is a heterocyclic compound characterized by its fused ring system, which includes a furoquinoxaline structure. This compound features a bromine substituent at the 3-position and a phenyl group at the 2-position of the furoquinoxaline framework. The presence of the bromine atom introduces notable reactivity, making it a potential candidate for various chemical reactions, including electrophilic substitutions. The furoquinoxaline moiety contributes to its aromaticity and stability, while also influencing its electronic properties. This compound may exhibit interesting photophysical properties, making it relevant in fields such as organic electronics or photochemistry. Additionally, its structural characteristics may impart biological activity, warranting investigation for potential pharmaceutical applications. As with many heterocycles, the solubility and reactivity can vary based on the solvent and conditions, which is crucial for its practical applications in research and industry. Overall, 3-bromo-2-phenylfuro[2,3-b]quinoxaline represents a versatile compound with potential utility in various chemical and biological contexts.
Formula:C16H9BrN2O
InChI:InChI=1/C16H9BrN2O/c17-13-14-16(19-12-9-5-4-8-11(12)18-14)20-15(13)10-6-2-1-3-7-10/h1-9H
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
