CAS 88051-71-2

4-Oxazolidinone, 5-phenyl-3-(phenylamino)-5-(phenylmethyl)-2-thioxo-

Description:

4-Oxazolidinone, 5-phenyl-3-(phenylamino)-5-(phenylmethyl)-2-thioxo- is a chemical compound characterized by its oxazolidinone core structure, which features a five-membered ring containing both nitrogen and oxygen atoms. This compound includes a thioxo group, indicating the presence of a sulfur atom double-bonded to a carbon atom, contributing to its reactivity and potential biological activity. The presence of multiple phenyl groups suggests that it may exhibit significant aromatic character, which can influence its solubility and interaction with other molecules. Such compounds often have applications in medicinal chemistry, potentially serving as intermediates in the synthesis of pharmaceuticals or as active pharmaceutical ingredients themselves. The specific arrangement of substituents on the oxazolidinone ring can affect the compound's pharmacological properties, including its efficacy and safety profile. As with many organic compounds, the stability, reactivity, and biological activity of this substance would depend on its molecular structure and the functional groups present.

Formula: C₂₂H₁₈N₂O₂S

InChI: InChI=1S/C22H18N2O2S/c25-20-22(18-12-6-2-7-13-18,16-17-10-4-1-5-11-17)26-21(27)24(20)23-19-14-8-3-9-15-19/h1-15,23H,16H2

InChI key: FVHFUZDYTWOTBW-UHFFFAOYSA-N

SMILES: C1=CC=C(C=C1)CC2(C(=O)N(C(=S)O2)NC3=CC=CC=C3)C4=CC=CC=C4