CAS 88053-18-3

Phosphoric acid, dicyclopentyl 2,2-dichloroethenyl ester

Description:

Phosphoric acid, dicyclopentyl 2,2-dichloroethenyl ester, identified by CAS number 88053-18-3, is an organophosphorus compound characterized by its ester functional group derived from phosphoric acid. This compound typically exhibits properties associated with esters, such as being a colorless to pale yellow liquid with a characteristic odor. It is generally soluble in organic solvents but has limited solubility in water. The presence of the dicyclopentyl group contributes to its hydrophobic characteristics, while the 2,2-dichloroethenyl moiety may impart unique reactivity and stability features. This compound is often utilized in various industrial applications, including as a chemical intermediate or in formulations requiring specific reactivity profiles. Safety considerations are important, as organophosphorus compounds can exhibit toxicity; thus, appropriate handling and storage measures are essential. Overall, the compound's unique structure and properties make it of interest in both research and industrial contexts.

Formula: C₁₂H₁₉Cl₂O₄P

InChI: InChI=1S/C12H19Cl2O4P/c13-12(14)9-16-19(15,17-10-5-1-2-6-10)18-11-7-3-4-8-11/h9-11H,1-8H2

InChI key: ISYRQAPJDGORGO-UHFFFAOYSA-N

SMILES: C1CCC(C1)OP(=O)(OC=C(Cl)Cl)OC2CCCC2