CAS 88053-19-4

Phosphoric acid, cyclopentyl 2,2-dichloroethenyl methyl ester

Description:

Phosphoric acid, cyclopentyl 2,2-dichloroethenyl methyl ester, with the CAS number 88053-19-4, is an organophosphorus compound characterized by its ester functional group derived from phosphoric acid. This compound features a cyclopentyl group, which contributes to its unique structural properties, and a 2,2-dichloroethenyl moiety that enhances its reactivity and potential applications in various chemical processes. Typically, such esters exhibit moderate to high polarity due to the presence of the phosphoric acid backbone, which can influence their solubility in polar solvents. The presence of chlorine atoms in the structure may impart additional characteristics such as increased stability and potential bioactivity. This compound may be utilized in agricultural chemistry, particularly as a pesticide or herbicide, owing to its phosphoric acid derivative nature. Safety and handling precautions are essential, as organophosphorus compounds can exhibit toxicity. Overall, the unique combination of functional groups in this compound suggests a range of potential applications in both industrial and research settings.

Formula: C₈H₁₃Cl₂O₄P

InChI: InChI=1S/C8H13Cl2O4P/c1-12-15(11,13-6-8(9)10)14-7-4-2-3-5-7/h6-7H,2-5H2,1H3

InChI key: PHRPKBVKWGQBMW-UHFFFAOYSA-N

SMILES: COP(=O)(OC=C(Cl)Cl)OC1CCCC1