CAS 88053-34-3

2-Naphthalenol, 3-methoxy-, acetate

Description:

2-Naphthalenol, 3-methoxy-, acetate, with the CAS number 88053-34-3, is an organic compound characterized by its structure, which includes a naphthalene ring substituted with a methoxy group and an acetate functional group. This compound typically appears as a colorless to pale yellow liquid or solid, depending on its purity and form. It is known for its aromatic properties and may exhibit moderate solubility in organic solvents while being less soluble in water. The presence of the methoxy and acetate groups can influence its reactivity, making it a potential candidate for various chemical reactions, including esterification and nucleophilic substitutions. Additionally, this compound may have applications in organic synthesis, fragrance formulations, and as an intermediate in the production of other chemical substances. Safety data should be consulted for handling and exposure guidelines, as with any chemical substance, to ensure proper safety measures are taken during its use.

Formula: C₁₃H₁₂O₃

InChI: InChI=1S/C11H10O2.C2H4O2/c1-13-11-7-9-5-3-2-4-8(9)6-10(11)12;1-2(3)4/h2-7,12H,1H3;1H3,(H,3,4)

InChI key: FMAJZKCHXHZHPH-UHFFFAOYSA-N

SMILES: CC(=O)O.COC1=CC2=CC=CC=C2C=C1O