CAS 88053-77-4

L-Threoninamide, N-[(1,1-dimethylethoxy)carbonyl]-L-leucyl-

Description:

L-Threoninamide, N-[(1,1-dimethylethoxy)carbonyl]-L-leucyl- is a synthetic compound that belongs to the class of amino acid derivatives. It features a threonine moiety, which is an essential amino acid, and is modified with an amide functional group. The presence of the N-[(1,1-dimethylethoxy)carbonyl] group indicates that it has a protective carbonyl group that can influence its reactivity and solubility. This compound is likely to exhibit characteristics typical of amino acids, such as the ability to form hydrogen bonds and participate in various biochemical reactions. Its structure suggests potential applications in peptide synthesis or as a building block in pharmaceuticals, particularly in the development of peptide-based drugs. The CAS number 88053-77-4 uniquely identifies this compound in chemical databases, facilitating its study and application in research and industry. Overall, L-Threoninamide, N-[(1,1-dimethylethoxy)carbonyl]-L-leucyl- is a versatile compound with potential utility in medicinal chemistry and biochemistry.

Formula: C₁₅H₂₉N₃O₅

InChI: InChI=1S/C15H29N3O5/c1-8(2)7-10(17-14(22)23-15(4,5)6)13(21)18-11(9(3)19)12(16)20/h8-11,19H,7H2,1-6H3,(H2,16,20)(H,17,22)(H,18,21)/t9-,10+,11+/m1/s1

InChI key: OZBLRPTZRHOWMN-VWYCJHECSA-N

SMILES: C[C@H]([C@@H](C(=O)N)NC(=O)[C@H](CC(C)C)NC(=O)OC(C)(C)C)O