CAS 88054-17-5
:2,4-Dimethylimidazole
Description:
2,4-Dimethylimidazole is an organic compound characterized by its imidazole ring, which is a five-membered heterocyclic structure containing two nitrogen atoms. This compound features two methyl groups attached to the 2 and 4 positions of the imidazole ring, influencing its chemical properties and reactivity. It is a colorless to pale yellow liquid or solid, depending on the temperature and purity. 2,4-Dimethylimidazole is known for its role as a catalyst in various chemical reactions, particularly in the synthesis of polyurethanes and other polymers. It exhibits basic properties due to the presence of nitrogen atoms in the ring, allowing it to participate in proton transfer reactions. Additionally, it has applications in the pharmaceutical industry and as a building block in organic synthesis. The compound is soluble in polar solvents, and its stability can be affected by environmental factors such as temperature and pH. Safety precautions should be taken when handling this substance, as it may pose health risks if ingested or inhaled.
Formula:C5H8N2
InChI:InChI=1S/C5H8N2/c1-4-3-6-5(2)7-4/h3H,1-2H3,(H,6,7)
InChI key:InChIKey=LLPKQRMDOFYSGZ-UHFFFAOYSA-N
SMILES:CC=1NC(C)=NC1
Synonyms:- 1H-Imidazole, 2,5-dimethyl-
- 2,5-Dimethyl-1H-imidazole
- Imidazole, 2,4-dimethyl-
- 1H-Imidazole, 2,4-dimethyl-
- Imidazole, 2,4(or 2,5)-dimethyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
