CymitQuimica logo

CAS 88054-33-5

:

(4R,5R)-9-fluoro-4,5-dihydrobenzo[pqr]tetraphene-4,5-diol

Description:
(4R,5R)-9-fluoro-4,5-dihydrobenzo[pqr]tetraphene-4,5-diol is a polycyclic aromatic compound characterized by its complex fused ring structure, which includes multiple aromatic systems. The presence of a fluorine atom introduces unique electronic properties, potentially enhancing its reactivity and influencing its interactions with other molecules. The diol functional groups (hydroxyl groups) at the 4 and 5 positions contribute to its solubility and reactivity, allowing for hydrogen bonding and potential participation in various chemical reactions. This compound may exhibit interesting optical properties due to its extended π-conjugated system, making it a candidate for applications in organic electronics or photonics. Additionally, the stereochemistry indicated by the (4R,5R) configuration suggests specific spatial arrangements that could affect its biological activity and interactions with other chemical entities. Overall, the unique structural features of this compound make it a subject of interest in both synthetic and applied chemistry contexts.
Formula:C20H13FO2
InChI:InChI=1/C20H13FO2/c21-12-6-4-11-8-16-18-13(15(11)9-12)7-5-10-2-1-3-14(17(10)18)19(22)20(16)23/h1-9,19-20,22-23H/t19-,20-/m1/s1
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.