CymitQuimica logo

CAS 88054-38-0

:

(8S,9S)-4-(hydroxymethyl)-8,9-dihydrotetraphene-8,9-diol

Description:
The chemical substance known as "(8S,9S)-4-(hydroxymethyl)-8,9-dihydrotetraphene-8,9-diol," with the CAS number 88054-38-0, is a polycyclic aromatic compound characterized by its complex structure, which includes multiple fused aromatic rings. This compound features hydroxymethyl and diol functional groups, contributing to its potential reactivity and solubility properties. The stereochemistry indicated by the (8S,9S) configuration suggests specific spatial arrangements of atoms, which can influence its biological activity and interactions with other molecules. Such compounds are often studied for their potential applications in organic electronics, materials science, and medicinal chemistry due to their unique electronic properties and ability to form π-stacking interactions. Additionally, the presence of hydroxyl groups may enhance hydrogen bonding capabilities, affecting solubility in polar solvents and biological systems. Overall, this compound exemplifies the intricate relationship between molecular structure and chemical behavior, making it a subject of interest in various fields of research.
Formula:C19H16O3
InChI:InChI=1/C19H16O3/c20-10-13-2-1-3-15-14(13)6-4-11-9-17-12(8-16(11)15)5-7-18(21)19(17)22/h1-9,18-22H,10H2/t18-,19-/m0/s1
Synonyms:
  • Benz(a)anthracene-8,9-diol, 8,9-dihydro-4-(hydroxymethyl)-, (8S-trans)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.