CymitQuimica logo

CAS 88054-39-1

:

(10S,11S)-4-(hydroxymethyl)-10,11-dihydrotetraphene-10,11-diol

Description:
The chemical substance known as "(10S,11S)-4-(hydroxymethyl)-10,11-dihydrotetraphene-10,11-diol," with the CAS number 88054-39-1, is a polycyclic aromatic compound characterized by its complex structure, which includes multiple fused aromatic rings. This compound features hydroxymethyl and diol functional groups, contributing to its potential reactivity and solubility in various solvents. The stereochemistry indicated by the (10S,11S) configuration suggests specific spatial arrangements of its atoms, which can influence its biological activity and interactions with other molecules. Such compounds are often studied for their potential applications in organic synthesis, materials science, and medicinal chemistry due to their unique electronic properties and ability to form π-stacking interactions. Additionally, the presence of hydroxyl groups may enhance hydrogen bonding capabilities, affecting the compound's physical properties, such as melting point and solubility. Overall, this substance represents a fascinating area of study within organic chemistry, particularly in the context of developing new materials or pharmaceuticals.
Formula:C19H16O3
InChI:InChI=1/C19H16O3/c20-10-13-2-1-3-15-14(13)6-4-11-8-12-5-7-18(21)19(22)17(12)9-16(11)15/h1-9,18-22H,10H2/t18-,19-/m0/s1
Synonyms:
  • Benz(a)anthracene-10,11-diol, 10,11-dihydro-4-(hydroxymethyl)-, (10S-trans)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.