CAS 88056-28-4
:[1-Ethyl-6-fluoro-1,4-dihydro-4-(oxo-κO)-7-(1-piperazinyl)-3-quinolinecarboxylato-κO3]silver
Description:
The chemical substance known as [1-Ethyl-6-fluoro-1,4-dihydro-4-(oxo-κO)-7-(1-piperazinyl)-3-quinolinecarboxylato-κO3]silver, with the CAS number 88056-28-4, is a silver complex of a quinoline derivative. This compound features a quinoline backbone, which is characterized by a bicyclic structure containing a nitrogen atom in the aromatic ring. The presence of the ethyl and piperazinyl groups enhances its solubility and biological activity. The fluorine atom introduces unique electronic properties, potentially affecting the compound's reactivity and interaction with biological targets. The oxo group contributes to the coordination chemistry of the silver ion, which is known for its antimicrobial properties. As a silver complex, it may exhibit enhanced efficacy against various pathogens, making it of interest in medicinal chemistry and materials science. The compound's stability, solubility, and biological activity are influenced by its structural features, making it a subject of research in pharmacology and coordination chemistry.
Formula:C16H17AgFN3O3
InChI:InChI=1S/C16H18FN3O3.Ag/c1-2-19-9-11(16(22)23)15(21)10-7-12(17)14(8-13(10)19)20-5-3-18-4-6-20;/h7-9,18H,2-6H2,1H3,(H,22,23);/q;+1/p-1
InChI key:InChIKey=HDXQYLJUKLAYMH-UHFFFAOYSA-M
SMILES:C(C)N1C=2C(C=3C(=C1)C(=O)[O-][Ag+]O3)=CC(F)=C(C2)N4CCNCC4
Synonyms:- [1-Ethyl-6-fluoro-1,4-dihydro-4-(oxo-κO)-7-(1-piperazinyl)-3-quinolinecarboxylato-κO3]silver
- 3-Quinolinecarboxylic acid, 1-ethyl-6-fluoro-1,4-dihydro-4-oxo-7-(1-piperazinyl)-, silver complex
- Silver, [1-ethyl-6-fluoro-1,4-dihydro-4-oxo-7-(1-piperazinyl)-3-quinolinecarboxylato-O3,O4]-
- Silver, [1-ethyl-6-fluoro-1,4-dihydro-4-(oxo-κO)-7-(1-piperazinyl)-3-quinolinecarboxylato-κO3]-
- Silver norfloxacin
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.