CAS 88059-53-4

Pyridine, 4-[5-(4-methylphenyl)-1,2,4-oxadiazol-3-yl]-

Description:

Pyridine, 4-[5-(4-methylphenyl)-1,2,4-oxadiazol-3-yl]- is a chemical compound characterized by its heterocyclic structure, which includes a pyridine ring and an oxadiazole moiety. The presence of the pyridine ring contributes to its aromatic properties and potential basicity, while the oxadiazole group can impart unique reactivity and stability characteristics. This compound is typically used in various fields, including pharmaceuticals and materials science, due to its potential biological activity and ability to form coordination complexes. It may exhibit properties such as solubility in organic solvents and moderate stability under standard conditions. The presence of the 4-methylphenyl substituent enhances its lipophilicity, which can influence its interaction with biological systems. Overall, this compound's unique structural features make it a subject of interest for research and application in synthetic chemistry and drug development.

Formula: C₁₄H₁₁N₃O

InChI: InChI=1S/C14H11N3O/c1-10-2-4-12(5-3-10)14-16-13(17-18-14)11-6-8-15-9-7-11/h2-9H,1H3

InChI key: CCQIPXRDRNIAKX-UHFFFAOYSA-N

SMILES: CC1=CC=C(C=C1)C2=NC(=NO2)C3=CC=NC=C3