CAS 88061-25-0

4H-1,3-Thiazin-4-one, 2-methyl-6-(phenylmethyl)-

Description:

4H-1,3-Thiazin-4-one, 2-methyl-6-(phenylmethyl)-, with the CAS number 88061-25-0, is a heterocyclic compound characterized by a thiazine ring structure. This compound features a sulfur atom and a nitrogen atom within its six-membered ring, contributing to its unique chemical properties. The presence of a methyl group and a phenylmethyl substituent enhances its lipophilicity, potentially influencing its biological activity and solubility in organic solvents. Thiazine derivatives are often studied for their pharmacological properties, including antimicrobial and anti-inflammatory activities. The compound's structure allows for various interactions, such as hydrogen bonding and π-π stacking, which may play a role in its reactivity and interactions with biological targets. Additionally, the thiazine ring can undergo various chemical transformations, making it a versatile scaffold in medicinal chemistry. Overall, this compound exemplifies the complexity and utility of heterocyclic compounds in drug design and development.

Formula: C₁₂H₁₁NOS

InChI: InChI=1S/C12H11NOS/c1-9-13-12(14)8-11(15-9)7-10-5-3-2-4-6-10/h2-6,8H,7H2,1H3

InChI key: OCNVXETVTCTGDQ-UHFFFAOYSA-N

SMILES: CC1=NC(=O)C=C(S1)CC2=CC=CC=C2