
CAS 88061-66-9
:N-Methyl-D-alanine methyl ester
Description:
N-Methyl-D-alanine methyl ester is an organic compound characterized by its structure, which includes a methyl group attached to the nitrogen of the D-alanine amino acid, along with a methyl ester functional group. This compound is typically a white to off-white solid or a viscous liquid, depending on its purity and specific conditions. It is soluble in polar solvents such as water and methanol, which is indicative of its polar nature due to the presence of the amino and ester functional groups. N-Methyl-D-alanine methyl ester is often utilized in biochemical research and synthesis, particularly in studies involving peptide synthesis and as a building block in the development of pharmaceuticals. Its unique structural features may influence its biological activity, making it of interest in various applications, including drug design and development. As with many chemical substances, proper handling and safety precautions are essential due to potential toxicity or reactivity.
Formula:C5H11NO2
InChI:InChI=1S/C5H11NO2/c1-4(6-2)5(7)8-3/h4,6H,1-3H3/t4-/m1/s1
InChI key:InChIKey=PQIUHUKRJAOTLS-SCSAIBSYSA-N
SMILES:[C@@H](C(OC)=O)(NC)C
Synonyms:- N-Methyl-D-alanine methyl ester
- D-Alanine, N-methyl-, methyl ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.