CAS 88062-16-2

Benzaldehyde, 2-chloro-3-hydroxy-6-nitro-4-(2-propenyloxy)-

Description:

Benzaldehyde, 2-chloro-3-hydroxy-6-nitro-4-(2-propenyloxy)-, with the CAS number 88062-16-2, is an organic compound characterized by its complex structure that includes a benzaldehyde moiety, a chloro group, a hydroxy group, and a nitro group, along with a propenyloxy substituent. This compound typically exhibits a yellow to brown color and is likely to be a solid at room temperature. It is expected to be soluble in organic solvents due to its aromatic nature, while its solubility in water may be limited due to the presence of hydrophobic groups. The presence of the nitro group suggests potential reactivity, particularly in electrophilic substitution reactions. Additionally, the hydroxy group can participate in hydrogen bonding, influencing its physical properties and reactivity. This compound may have applications in organic synthesis, pharmaceuticals, or as an intermediate in chemical manufacturing, although specific applications would depend on further research into its properties and behavior in various chemical contexts.

Formula: C₁₀H₈ClNO₅

InChI: InChI=1S/C10H8ClNO5/c1-2-3-17-8-4-7(12(15)16)6(5-13)9(11)10(8)14/h2,4-5,14H,1,3H2

InChI key: VZKMWWMQKQAWFS-UHFFFAOYSA-N

SMILES: C=CCOC1=C(C(=C(C(=C1)[N+](=O)[O-])C=O)Cl)O