CAS 88062-41-3

6H-1,3,4-Oxadiazin-6-one, 4,5-dihydro-4-methyl-5-phenyl-, (R)-

Description:

6H-1,3,4-Oxadiazin-6-one, 4,5-dihydro-4-methyl-5-phenyl-, (R)-, with CAS number 88062-41-3, is a heterocyclic organic compound characterized by its oxadiazine ring structure. This compound features a five-membered ring containing two nitrogen atoms and three carbon atoms, along with a carbonyl group, which contributes to its stability and reactivity. The presence of the methyl and phenyl substituents enhances its lipophilicity and may influence its biological activity. The (R)- designation indicates that the compound has a specific stereochemistry, which can be crucial for its interaction with biological targets. Typically, compounds of this class may exhibit various pharmacological properties, making them of interest in medicinal chemistry. The compound's solubility, melting point, and other physical properties would depend on its specific molecular interactions and substituents. Overall, this oxadiazin derivative represents a class of compounds that may have potential applications in pharmaceuticals or agrochemicals, warranting further investigation into its properties and uses.

Formula: C₁₀H₁₀N₂O₂

InChI: InChI=1S/C10H10N2O2/c1-12-9(10(13)14-7-11-12)8-5-3-2-4-6-8/h2-7,9H,1H3/t9-/m1/s1

InChI key: VIJMCNRIJRGUOI-SECBINFHSA-N

SMILES: CN1[C@@H](C(=O)OC=N1)C2=CC=CC=C2