CAS 88063-82-5

Silanamine, 1,1,1-triphenoxy-N-phenyl-

Description:

Silanamine, 1,1,1-triphenoxy-N-phenyl- (CAS 88063-82-5) is an organosilicon compound characterized by its silane functional group combined with a triphenoxy and phenyl moiety. This compound typically exhibits properties associated with silanes, such as reactivity with moisture, which can lead to the formation of siloxane networks. It is likely to be a colorless to pale yellow liquid or solid, depending on its specific formulation and purity. The presence of multiple phenoxy groups suggests potential applications in enhancing adhesion, as well as serving as a coupling agent in various materials, including polymers and composites. Additionally, the compound may exhibit moderate to high thermal stability and could be sensitive to hydrolysis, releasing phenol and silanol upon reaction with water. Safety data should be consulted for handling, as organosilicon compounds can vary in toxicity and environmental impact. Overall, this compound's unique structure positions it for specialized applications in materials science and chemical synthesis.

Formula: C₂₄H₂₁NO₃Si

InChI: InChI=1S/C24H21NO3Si/c1-5-13-21(14-6-1)25-29(26-22-15-7-2-8-16-22,27-23-17-9-3-10-18-23)28-24-19-11-4-12-20-24/h1-20,25H

InChI key: LYBHYRUHLFXPMI-UHFFFAOYSA-N

SMILES: C1=CC=C(C=C1)N[Si](OC2=CC=CC=C2)(OC3=CC=CC=C3)OC4=CC=CC=C4