CAS 880653-70-3

1H-Inden-1-ol, 4-bromo-2,3-dihydro-2-methyl-

Description:

1H-Inden-1-ol, 4-bromo-2,3-dihydro-2-methyl- is an organic compound characterized by its bicyclic structure, which includes an indene framework with a hydroxyl group (-OH) and a bromine substituent. The presence of the hydroxyl group indicates that it is an alcohol, which can participate in hydrogen bonding, potentially influencing its solubility and reactivity. The bromine atom introduces a halogen functionality, which can enhance the compound's reactivity in nucleophilic substitution reactions. The dihydro and methyl groups contribute to the compound's overall stability and steric properties. This compound may exhibit interesting biological activities and could be of interest in synthetic organic chemistry for the development of pharmaceuticals or agrochemicals. Its specific physical and chemical properties, such as boiling point, melting point, and solubility, would depend on the molecular interactions and the presence of functional groups. As with many organic compounds, safety and handling precautions should be observed due to potential toxicity or reactivity associated with brominated compounds.

Formula: C₁₀H₁₁BrO

InChI: InChI=1S/C10H11BrO/c1-6-5-8-7(10(6)12)3-2-4-9(8)11/h2-4,6,10,12H,5H2,1H3

InChI key: ZNUYQILMSVDWLL-UHFFFAOYSA-N

SMILES: CC1CC2=C(C1O)C=CC=C2Br