CAS 88066-99-3

Acetamide, 2,2-dichloro-N-[(2-methyl-1,3-dioxolan-2-yl)methyl]-

Description:

Acetamide, 2,2-dichloro-N-[(2-methyl-1,3-dioxolan-2-yl)methyl]- is an organic compound characterized by its amide functional group, which is derived from acetic acid. This compound features a dichloro substitution, indicating the presence of two chlorine atoms attached to the carbon backbone, which can influence its reactivity and physical properties. The presence of the 2-methyl-1,3-dioxolane moiety suggests that it has a cyclic ether structure, contributing to its overall stability and solubility characteristics. Typically, compounds of this nature exhibit moderate polarity due to the amide group, which can engage in hydrogen bonding, enhancing solubility in polar solvents. The dichloro substitution may also impart unique biological or chemical activity, making it of interest in various applications, including pharmaceuticals or agrochemicals. Safety data should be consulted for handling and potential toxicity, as halogenated compounds can exhibit varying degrees of environmental persistence and biological effects. Overall, this compound represents a complex structure with potential utility in chemical synthesis and research.

Formula: C₇H₁₁Cl₂NO₃

InChI: InChI=1S/C7H11Cl2NO3/c1-7(12-2-3-13-7)4-10-6(11)5(8)9/h5H,2-4H2,1H3,(H,10,11)

InChI key: DMZCICAKIAWILO-UHFFFAOYSA-N

SMILES: CC1(OCCO1)CNC(=O)C(Cl)Cl