CAS 88067-35-0

1,3,5-Triazine-2,4-diamine, N-(3-methyl-1,2,4-oxadiazol-5-yl)-

Description:

1,3,5-Triazine-2,4-diamine, N-(3-methyl-1,2,4-oxadiazol-5-yl)-, also known by its CAS number 88067-35-0, is a chemical compound characterized by its triazine core, which is a six-membered heterocyclic ring containing three nitrogen atoms. This compound features two amino groups at the 2 and 4 positions of the triazine ring, contributing to its potential as a building block in various chemical syntheses. The presence of the 3-methyl-1,2,4-oxadiazol-5-yl substituent introduces additional functional properties, enhancing its reactivity and potential applications in fields such as agrochemicals or pharmaceuticals. The compound is likely to exhibit moderate solubility in polar solvents due to the presence of amino groups, which can engage in hydrogen bonding. Its stability and reactivity can be influenced by the electronic effects of the substituents, making it a subject of interest for further research in material science and medicinal chemistry. Overall, this compound exemplifies the diverse chemistry of heterocyclic compounds and their utility in various applications.

Formula: C₆H₇N₇O

InChI: InChI=1S/C6H7N7O/c1-3-10-6(14-13-3)12-5-9-2-8-4(7)11-5/h2H,1H3,(H3,7,8,9,10,11,12,13)

InChI key: YMAIBGOQRURMNT-UHFFFAOYSA-N

SMILES: CC1=NOC(=N1)NC2=NC=NC(=N2)N