CAS 88067-46-3

Piperidine, 2-ethenyl-1-propyl-

Description:

Piperidine, 2-ethenyl-1-propyl- is an organic compound characterized by its piperidine ring, which is a six-membered saturated nitrogen-containing heterocycle. The structure features a propyl group and a vinyl group (ethenyl) attached to the nitrogen atom and the carbon framework, respectively. This compound is typically colorless to pale yellow and may have a distinct odor. It is soluble in organic solvents and may exhibit moderate solubility in water due to the presence of the nitrogen atom, which can engage in hydrogen bonding. Piperidine derivatives are known for their applications in organic synthesis and as intermediates in the production of pharmaceuticals and agrochemicals. The presence of the vinyl group may impart reactivity, making it useful in various chemical reactions, including polymerization and cross-coupling reactions. Safety data should be consulted, as piperidine derivatives can pose health risks, including irritation to the skin, eyes, and respiratory system. Proper handling and storage conditions are essential to ensure safety when working with this compound.

Formula: C₁₀H₁₉N

InChI: InChI=1S/C10H19N/c1-3-8-11-9-6-5-7-10(11)4-2/h4,10H,2-3,5-9H2,1H3

InChI key: MAPKUMZMWREIEA-UHFFFAOYSA-N

SMILES: CCCN1CCCCC1C=C