CAS 88068-15-9

Cyclobutanol, 1-butyl-3-(phenylsulfonyl)-3-(trimethylsilyl)-

Description:

Cyclobutanol, 1-butyl-3-(phenylsulfonyl)-3-(trimethylsilyl)-, identified by CAS number 88068-15-9, is an organic compound characterized by its cyclobutane ring structure, which is a four-membered cyclic alkane. This compound features a butyl group and a phenylsulfonyl moiety, contributing to its unique chemical properties. The presence of the trimethylsilyl group enhances its stability and solubility in organic solvents, making it useful in various synthetic applications. Cyclobutanol derivatives often exhibit interesting reactivity due to the strain in the cyclobutane ring, which can lead to unique reaction pathways. Additionally, the sulfonyl group can participate in nucleophilic substitution reactions, further expanding its utility in organic synthesis. The compound's physical properties, such as boiling point and melting point, are influenced by its molecular structure and substituents. Overall, this compound is of interest in the field of organic chemistry for its potential applications in synthesis and as a building block for more complex molecules.

Formula: C₁₇H₂₈O₃SSi

InChI: InChI=1S/C17H28O3SSi/c1-5-6-12-16(18)13-17(14-16,22(2,3)4)21(19,20)15-10-8-7-9-11-15/h7-11,18H,5-6,12-14H2,1-4H3

InChI key: MTZBPUCDIZIKFE-UHFFFAOYSA-N

SMILES: CCCCC1(CC(C1)([Si](C)(C)C)S(=O)(=O)C2=CC=CC=C2)O